CAS 1634668-56-6 is the registry number for 4,4'-(Pyrene-1,6-diyl)dianiline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[6-(4-aminophenyl)pyren-1-yl]aniline (CAS 1634668-56-6) is a chemical compound with the molecular formula C28H20N2 and a molecular weight of 384.5 g/mol. IUPAC name: 4-[6-(4-aminophenyl)pyren-1-yl]aniline. InChIKey: ROWVQVZYXLSKNR-UHFFFAOYSA-N.
| Molecular formula | C28H20N2 |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | 4-[6-(4-aminophenyl)pyren-1-yl]aniline |
| InChIKey | ROWVQVZYXLSKNR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CC3=C4C2=C1C=CC4=C(C=C3)C5=CC=C(C=C5)N)C6=CC=C(C=C6)N |
Computed by PubChem (NCBI)