CAS 16348-04-2 is the registry number for N-(4-Toyl)barbituric Acid. Offered by: TRC. Available pack sizes: 500mg.
1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione (CAS 16348-04-2) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione. InChIKey: WLGYFVCNEFNYKO-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione |
| InChIKey | WLGYFVCNEFNYKO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=O)CC(=O)NC2=O |
Computed by PubChem (NCBI)