CAS 163563-07-3 is the registry number for 2-Chloro-5-(m-tolyl)pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-chloro-5-(3-methylphenyl)pyridine (CAS 163563-07-3) is a chemical compound with the molecular formula C12H10ClN and a molecular weight of 203.67 g/mol. IUPAC name: 2-chloro-5-(3-methylphenyl)pyridine. InChIKey: LOIIRZHGQLGKQZ-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN |
|---|---|
| Molecular weight | 203.67 g/mol |
| IUPAC name | 2-chloro-5-(3-methylphenyl)pyridine |
| InChIKey | LOIIRZHGQLGKQZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)