Products 1636-34-6
CAS 1636-34-6 appears in our catalog under these names: 2,3–Diphenyl–2,3–butanediol, 2,3-Diphenylbutane-2,3-diol, >98.0%(GC), 2,3-Diphenylbutane-2,3-diol 98+%, 2,3-Diphenylbutane-2,3-diol, 98%, 98%, 2,3-Diphenylbutane-2,3-diol, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 200mg, 250mg, 100mg.
2,3-diphenylbutane-2,3-diol (CAS 1636-34-6) is a chemical compound with the molecular formula C16H18O2 and a molecular weight of 242.31 g/mol. IUPAC name: 2,3-diphenylbutane-2,3-diol. InChIKey: URPRLFISKOCZHR-UHFFFAOYSA-N.
| Molecular formula | C16H18O2 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | 2,3-diphenylbutane-2,3-diol |
| InChIKey | URPRLFISKOCZHR-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)(C(C)(C2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)