CAS 163679-36-5 is the registry number for 2–amino–3–(4–benzoylphenyl)propanoicacidhydrochloride. Offered by: GLPBio. Available pack sizes: 20mg.
2-amino-3-(4-benzoylphenyl)propanoic acid;hydrochloride (CAS 163679-36-5) is a chemical compound with the molecular formula C16H16ClNO3 and a molecular weight of 305.75 g/mol. IUPAC name: 2-amino-3-(4-benzoylphenyl)propanoic acid;hydrochloride. InChIKey: XVJIYFOSPMCXHG-UHFFFAOYSA-N.
| Molecular formula | C16H16ClNO3 |
|---|---|
| Molecular weight | 305.75 g/mol |
| IUPAC name | 2-amino-3-(4-benzoylphenyl)propanoic acid;hydrochloride |
| InChIKey | XVJIYFOSPMCXHG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)