CAS 335428-52-9 is the registry number for Ethyl 8–chloro–1–cyclopropyl–9–methyl–4–oxo–4H–quinolizine–3–carboxylate. Offered by: GLPBio. Available pack sizes: 10mg.
Ethyl 8-chloro-1-cyclopropyl-9-methyl-4-oxoquinolizine-3-carboxylate (CAS 335428-52-9) is a chemical compound with the molecular formula C16H16ClNO3 and a molecular weight of 305.75 g/mol. IUPAC name: ethyl 8-chloro-1-cyclopropyl-9-methyl-4-oxoquinolizine-3-carboxylate. InChIKey: RCPDCUKLCLYADY-UHFFFAOYSA-N.
| Molecular formula | C16H16ClNO3 |
|---|---|
| Molecular weight | 305.75 g/mol |
| IUPAC name | ethyl 8-chloro-1-cyclopropyl-9-methyl-4-oxoquinolizine-3-carboxylate |
| InChIKey | RCPDCUKLCLYADY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C2C(=C(C=CN2C1=O)Cl)C)C3CC3 |
Computed by PubChem (NCBI)