CAS 314245-31-3 appears in our catalog under these names: 4-[3-(2-Chloro-acetyl)-2,5-dimethyl-pyrrol-1-yl]-benzoic acid methyl ester, 95%, Methyl 4-(3-(2-chloroacetyl)-2,5-dimethyl-1H-pyrrol-1-yl)benzoate, 95%, Methyl 4-(3-(2-chloroacetyl)-2,5-dimethyl-1H-pyrrol-1-yl)benzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
Methyl 4-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]benzoate (CAS 314245-31-3) is a chemical compound with the molecular formula C16H16ClNO3 and a molecular weight of 305.75 g/mol. IUPAC name: methyl 4-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]benzoate. InChIKey: LDMHYAVGVRJERG-UHFFFAOYSA-N.
| Molecular formula | C16H16ClNO3 |
|---|---|
| Molecular weight | 305.75 g/mol |
| IUPAC name | methyl 4-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]benzoate |
| InChIKey | LDMHYAVGVRJERG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=C(C=C2)C(=O)OC)C)C(=O)CCl |
Computed by PubChem (NCBI)