CAS 85145-24-0 is the registry number for (R)-Fenoldopam. Offered by: Chemat Brand. Available pack sizes: on request.
(5R)-9-chloro-5-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol (CAS 85145-24-0) is a chemical compound with the molecular formula C16H16ClNO3 and a molecular weight of 305.75 g/mol. IUPAC name: (5R)-9-chloro-5-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol. InChIKey: TVURRHSHRRELCG-CYBMUJFWSA-N.
| Molecular formula | C16H16ClNO3 |
|---|---|
| Molecular weight | 305.75 g/mol |
| IUPAC name | (5R)-9-chloro-5-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol |
| InChIKey | TVURRHSHRRELCG-CYBMUJFWSA-N |
| SMILES | C1CNC[C@@H](C2=CC(=C(C(=C21)Cl)O)O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)