CAS 16372-95-5 appears in our catalog under these names: 3,5-Dibromo-[1,1'-biphenyl]-2-amine, ≥95%, ≥95%, 3,5-Dibromo-biphenyl-2-ylamine, 95%, 2,4-Dibromo-6-phenyl-aniline, 95%, 3,5-Dibromo-[1,1'-biphenyl]-2-amine, ≥95%. Offered by: Chemat, Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 10g, 5g, 25g, 250mg.
2,4-dibromo-6-phenylaniline (CAS 16372-95-5) is a chemical compound with the molecular formula C12H9Br2N and a molecular weight of 327.01 g/mol. IUPAC name: 2,4-dibromo-6-phenylaniline. InChIKey: VBHIFDXFCGYZGI-UHFFFAOYSA-N.
| Molecular formula | C12H9Br2N |
|---|---|
| Molecular weight | 327.01 g/mol |
| IUPAC name | 2,4-dibromo-6-phenylaniline |
| InChIKey | VBHIFDXFCGYZGI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=CC(=C2)Br)Br)N |
Computed by PubChem (NCBI)