CAS 197961-37-8 is the registry number for 4,4'-Dibromo-[1,1'-biphenyl]-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-(4-bromophenyl)aniline (CAS 197961-37-8) is a chemical compound with the molecular formula C12H9Br2N and a molecular weight of 327.01 g/mol. IUPAC name: 5-bromo-2-(4-bromophenyl)aniline. InChIKey: HLTBLXGLNPWUII-UHFFFAOYSA-N.
| Molecular formula | C12H9Br2N |
|---|---|
| Molecular weight | 327.01 g/mol |
| IUPAC name | 5-bromo-2-(4-bromophenyl)aniline |
| InChIKey | HLTBLXGLNPWUII-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)Br)N)Br |
Computed by PubChem (NCBI)