CAS 67242-17-5 appears in our catalog under these names: Bis(2-bromophenyl)amine, 95%, Bis(2–bromophenyl)amine, Bis(2-bromophenyl)amine 98%, Bis(2-bromophenyl)amine, 98%, 98%, Bis(2-bromophenyl)amine, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
2-bromo-N-(2-bromophenyl)aniline (CAS 67242-17-5) is a chemical compound with the molecular formula C12H9Br2N and a molecular weight of 327.01 g/mol. IUPAC name: 2-bromo-N-(2-bromophenyl)aniline. InChIKey: BJPIBICIVXDVHC-UHFFFAOYSA-N.
| Molecular formula | C12H9Br2N |
|---|---|
| Molecular weight | 327.01 g/mol |
| IUPAC name | 2-bromo-N-(2-bromophenyl)aniline |
| InChIKey | BJPIBICIVXDVHC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC2=CC=CC=C2Br)Br |
Computed by PubChem (NCBI)