CAS 3366-59-4 appears in our catalog under these names: 4-Amino-3,5-dibromobiphenyl, 3,5-Dibromo-[1,1'-biphenyl]-4-amine 95%, 3,5-Dibromo-[1,1'-biphenyl]-4-amine, 98%, 3,5-Dibromo-[1,1'-biphenyl]-4-amine, 98%, 98%. Offered by: TRC, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 5g, 10g, 25g, 100g, 250mg.
2,6-dibromo-4-phenylaniline (CAS 3366-59-4) is a chemical compound with the molecular formula C12H9Br2N and a molecular weight of 327.01 g/mol. IUPAC name: 2,6-dibromo-4-phenylaniline. InChIKey: YQZVEDKKWNYZSF-UHFFFAOYSA-N.
| Molecular formula | C12H9Br2N |
|---|---|
| Molecular weight | 327.01 g/mol |
| IUPAC name | 2,6-dibromo-4-phenylaniline |
| InChIKey | YQZVEDKKWNYZSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C(=C2)Br)N)Br |
Computed by PubChem (NCBI)