CAS 1637453-69-0 appears in our catalog under these names: (1R)-4-chloro-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, (1R)-4-Chloro-2,3-dihydro-1H-inden-1-amine hydrochloride, (R)-4-Chloro-2,3-dihydro-1H-inden-1-amine hydrochloride, 98%, 98%, (R)-4-Chloro-2,3-dihydro-1H-inden-1-amine hydrochloride, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(1R)-4-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1637453-69-0) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: (1R)-4-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: YYLDPTIPXZCUCP-SBSPUUFOSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | (1R)-4-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | YYLDPTIPXZCUCP-SBSPUUFOSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=CC=C2Cl.Cl |
Computed by PubChem (NCBI)