Products 1637562-73-2
CAS 1637562-73-2 is the registry number for Methyl 5-methyl-2-(pyridin-3-yl)oxazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-methyl-2-pyridin-3-yl-1,3-oxazole-4-carboxylate (CAS 1637562-73-2) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: methyl 5-methyl-2-pyridin-3-yl-1,3-oxazole-4-carboxylate. InChIKey: PJSMWLYXJDQVJM-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | methyl 5-methyl-2-pyridin-3-yl-1,3-oxazole-4-carboxylate |
| InChIKey | PJSMWLYXJDQVJM-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CN=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)