Products 1638221-43-8
CAS 1638221-43-8 appears in our catalog under these names: 2,3-Dihydro-1H-inden-4-ylhydrazine hydrochloride, (2,3-dihydro-1H-inden-4-yl)hydrazine hydrochloride, >95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg.
2,3-dihydro-1H-inden-4-ylhydrazine;hydrochloride (CAS 1638221-43-8) is a chemical compound with the molecular formula C9H13ClN2 and a molecular weight of 184.66 g/mol. IUPAC name: 2,3-dihydro-1H-inden-4-ylhydrazine;hydrochloride. InChIKey: LAOVZPSSPYDQTE-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2 |
|---|---|
| Molecular weight | 184.66 g/mol |
| IUPAC name | 2,3-dihydro-1H-inden-4-ylhydrazine;hydrochloride |
| InChIKey | LAOVZPSSPYDQTE-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=CC=C2)NN.Cl |
Computed by PubChem (NCBI)