Products 1638766-91-2
CAS 1638766-91-2 is the registry number for ethyl 2-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate (CAS 1638766-91-2) is a chemical compound with the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. IUPAC name: ethyl 2-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate. InChIKey: CGBHTXJBCVXWGH-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | ethyl 2-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate |
| InChIKey | CGBHTXJBCVXWGH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=NC(=NC=C12)Cl |
Computed by PubChem (NCBI)