CAS 1638768-23-6 appears in our catalog under these names: 5-chloro-3-(trifluoromethyl)-1H-pyrazolo(4,3-b)pyridine, 95%, 5-chloro-3-(trifluoromethyl)-1H-pyrazolo[4,3-b]pyridine, 97%, 97%, 5-CHLORO-3-(TRIFLUOROMETHYL)-1H-PYRAZOLO[4,3-B]PYRIDINE, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
5-chloro-3-(trifluoromethyl)-2H-pyrazolo[4,3-b]pyridine (CAS 1638768-23-6) is a chemical compound with the molecular formula C7H3ClF3N3 and a molecular weight of 221.57 g/mol. IUPAC name: 5-chloro-3-(trifluoromethyl)-2H-pyrazolo[4,3-b]pyridine. InChIKey: PVQTYNOHVCYTOM-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3N3 |
|---|---|
| Molecular weight | 221.57 g/mol |
| IUPAC name | 5-chloro-3-(trifluoromethyl)-2H-pyrazolo[4,3-b]pyridine |
| InChIKey | PVQTYNOHVCYTOM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C(NN=C21)C(F)(F)F)Cl |
Computed by PubChem (NCBI)