CAS 1638772-03-8 appears in our catalog under these names: Trans-3-(boc-aminomethyl)cyclobutanecarboxylic acid, 95%, trans-3-(boc-aminomethyl)cyclobutanecarboxylic acid, 97%, trans-3-(Boc-aminomethyl)cyclobutanecarboxylic acid, trans-3-[[[(1,1-Dimethylethoxy)carbonyl]amino]methyl]cyclobutanecarboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 100mg, 10g, 5g, 1g, 250mg, 0,5g, 50mg, 500mg.
3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclobutane-1-carboxylic acid (CAS 1638772-03-8) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclobutane-1-carboxylic acid. InChIKey: NBZXLLZSQJEBME-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclobutane-1-carboxylic acid |
| InChIKey | NBZXLLZSQJEBME-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CC(C1)C(=O)O |
Computed by PubChem (NCBI)