CAS 163931-45-1 is the registry number for (E)-2-(Ethyl(4-((4-nitrophenyl)diazenyl)phenyl)amino)ethanol, 97%. Offered by: AmBeed. Available pack sizes: 25mg.
2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethanol (CAS 163931-45-1) is a chemical compound with the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. IUPAC name: 2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethanol. InChIKey: FOQABOMYTOFLPZ-UHFFFAOYSA-N.
| Molecular formula | C16H18N4O3 |
|---|---|
| Molecular weight | 314.34 g/mol |
| IUPAC name | 2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethanol |
| InChIKey | FOQABOMYTOFLPZ-UHFFFAOYSA-N |
| SMILES | CCN(CCO)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)