CAS 1771756-20-7 is the registry number for Dabigatran Etexilate Impurity 82. Offered by: Chemat Brand. Available pack sizes: on request.
3-[[3-amino-4-(methylamino)benzoyl]-pyridin-2-ylamino]propanoic acid (CAS 1771756-20-7) is a chemical compound with the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. IUPAC name: 3-[[3-amino-4-(methylamino)benzoyl]-pyridin-2-ylamino]propanoic acid. InChIKey: ZHUZECNFQOUJGD-UHFFFAOYSA-N.
| Molecular formula | C16H18N4O3 |
|---|---|
| Molecular weight | 314.34 g/mol |
| IUPAC name | 3-[[3-amino-4-(methylamino)benzoyl]-pyridin-2-ylamino]propanoic acid |
| InChIKey | ZHUZECNFQOUJGD-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)C(=O)N(CCC(=O)O)C2=CC=CC=N2)N |
Computed by PubChem (NCBI)