Products 1771756-20-7

CAS 1771756-20-7 is the registry number for Dabigatran Etexilate Impurity 82. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[[3-amino-4-(methylamino)benzoyl]-pyridin-2-ylamino]propanoic acid (CAS 1771756-20-7) is a chemical compound with the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. IUPAC name: 3-[[3-amino-4-(methylamino)benzoyl]-pyridin-2-ylamino]propanoic acid. InChIKey: ZHUZECNFQOUJGD-UHFFFAOYSA-N.

Identity
Molecular formulaC16H18N4O3
Molecular weight314.34 g/mol
IUPAC name3-[[3-amino-4-(methylamino)benzoyl]-pyridin-2-ylamino]propanoic acid
InChIKeyZHUZECNFQOUJGD-UHFFFAOYSA-N
SMILESCNC1=C(C=C(C=C1)C(=O)N(CCC(=O)O)C2=CC=CC=N2)N

Computed by PubChem (NCBI)