Products 4824-81-1
CAS 4824-81-1 is the registry number for N,N'-(Oxybis(2-amino-4,1-phenylene))diacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-(4-acetamido-3-aminophenoxy)-2-aminophenyl]acetamide (CAS 4824-81-1) is a chemical compound with the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. IUPAC name: N-[4-(4-acetamido-3-aminophenoxy)-2-aminophenyl]acetamide. InChIKey: BXSFBWMUDQFSEB-UHFFFAOYSA-N.
| Molecular formula | C16H18N4O3 |
|---|---|
| Molecular weight | 314.34 g/mol |
| IUPAC name | N-[4-(4-acetamido-3-aminophenoxy)-2-aminophenyl]acetamide |
| InChIKey | BXSFBWMUDQFSEB-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)OC2=CC(=C(C=C2)NC(=O)C)N)N |
Computed by PubChem (NCBI)