CAS 947601-97-0 is the registry number for Disperse Red 1 D3 (N-ethyl-2,2,2-D3). Offered by: Dr. Ehrenstorfer. Available pack sizes: 25mg.
2-[4-[(4-nitrophenyl)diazenyl]-N-(2,2,2-trideuterioethyl)anilino]ethanol (CAS 947601-97-0) is a chemical compound with the molecular formula C16H18N4O3 and a molecular weight of 317.36 g/mol. IUPAC name: 2-[4-[(4-nitrophenyl)diazenyl]-N-(2,2,2-trideuterioethyl)anilino]ethanol. InChIKey: FOQABOMYTOFLPZ-FIBGUPNXSA-N.
| Molecular formula | C16H18N4O3 |
|---|---|
| Molecular weight | 317.36 g/mol |
| IUPAC name | 2-[4-[(4-nitrophenyl)diazenyl]-N-(2,2,2-trideuterioethyl)anilino]ethanol |
| InChIKey | FOQABOMYTOFLPZ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CN(CCO)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)