CAS 16407-86-6 is the registry number for 4-Amino-5,7-dichloro-2,1,3-benzothiadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
5,7-dichloro-2,1,3-benzothiadiazol-4-amine (CAS 16407-86-6) is a chemical compound with the molecular formula C6H3Cl2N3S and a molecular weight of 220.08 g/mol. IUPAC name: 5,7-dichloro-2,1,3-benzothiadiazol-4-amine. InChIKey: BHDCZIZWPKHDHA-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3S |
|---|---|
| Molecular weight | 220.08 g/mol |
| IUPAC name | 5,7-dichloro-2,1,3-benzothiadiazol-4-amine |
| InChIKey | BHDCZIZWPKHDHA-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NSN=C2C(=C1Cl)N)Cl |
Computed by PubChem (NCBI)