CAS 7464-11-1 appears in our catalog under these names: 5,7–Dichloro–2–methylthiazolo(5,4–d)pyrimidine, 5,7-Dichloro-2-methylthiazolo[5,4-d]pyrimidine, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 50mg, 250mg, 1g.
5,7-dichloro-2-methyl-[1,3]thiazolo[5,4-d]pyrimidine (CAS 7464-11-1) is a chemical compound with the molecular formula C6H3Cl2N3S and a molecular weight of 220.08 g/mol. IUPAC name: 5,7-dichloro-2-methyl-[1,3]thiazolo[5,4-d]pyrimidine. InChIKey: ZXOQUXADNLREKJ-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3S |
|---|---|
| Molecular weight | 220.08 g/mol |
| IUPAC name | 5,7-dichloro-2-methyl-[1,3]thiazolo[5,4-d]pyrimidine |
| InChIKey | ZXOQUXADNLREKJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)