CAS 2407402-15-5 is the registry number for 4,6-Dichloro-3-methylisothiazolo[5,4-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-3-methyl-[1,2]thiazolo[5,4-d]pyrimidine (CAS 2407402-15-5) is a chemical compound with the molecular formula C6H3Cl2N3S and a molecular weight of 220.08 g/mol. IUPAC name: 4,6-dichloro-3-methyl-[1,2]thiazolo[5,4-d]pyrimidine. InChIKey: CLUHTHHZVCTKOY-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3S |
|---|---|
| Molecular weight | 220.08 g/mol |
| IUPAC name | 4,6-dichloro-3-methyl-[1,2]thiazolo[5,4-d]pyrimidine |
| InChIKey | CLUHTHHZVCTKOY-UHFFFAOYSA-N |
| SMILES | CC1=NSC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)