Products 243444-81-7
CAS 243444-81-7 is the registry number for 6,8-Dichloro-(1,2,4)triazolo(4,3-a)pyridine-3-thiol. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
6,8-dichloro-2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione (CAS 243444-81-7) is a chemical compound with the molecular formula C6H3Cl2N3S and a molecular weight of 220.08 g/mol. IUPAC name: 6,8-dichloro-2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione. InChIKey: JDSFMQYOLKDWJO-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3S |
|---|---|
| Molecular weight | 220.08 g/mol |
| IUPAC name | 6,8-dichloro-2H-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
| InChIKey | JDSFMQYOLKDWJO-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NNC(=S)N2C=C1Cl)Cl |
Computed by PubChem (NCBI)