CAS 1642801-93-1 is the registry number for 6'-Chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-c]pyridin]-2'(1'H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6'-chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-c]pyridine]-2'-one (CAS 1642801-93-1) is a chemical compound with the molecular formula C10H9ClN2O and a molecular weight of 208.64 g/mol. IUPAC name: 6'-chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-c]pyridine]-2'-one. InChIKey: CDBLRERTMOFODZ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 6'-chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-c]pyridine]-2'-one |
| InChIKey | CDBLRERTMOFODZ-UHFFFAOYSA-N |
| SMILES | CN1C2=CC(=NC=C2C3(C1=O)CC3)Cl |
Computed by PubChem (NCBI)