CAS 1643-71-6 appears in our catalog under these names: 2,3,5,6-Tetrafluoro-4-methoxyaniline, 95%, 2,3,5,6-Tetrafluoro-4-methoxyaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2,3,5,6-tetrafluoro-4-methoxyaniline (CAS 1643-71-6) is a chemical compound with the molecular formula C7H5F4NO and a molecular weight of 195.11 g/mol. IUPAC name: 2,3,5,6-tetrafluoro-4-methoxyaniline. InChIKey: PTDKAQCACRZBNQ-UHFFFAOYSA-N.
| Molecular formula | C7H5F4NO |
|---|---|
| Molecular weight | 195.11 g/mol |
| IUPAC name | 2,3,5,6-tetrafluoro-4-methoxyaniline |
| InChIKey | PTDKAQCACRZBNQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1F)F)N)F)F |
Computed by PubChem (NCBI)