Products 1644239-86-0
CAS 1644239-86-0 is the registry number for tert-Butyl 2-(1-Benzhydrylazetidin-3-ylidene)acetate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl 2-(1-benzhydrylazetidin-3-ylidene)acetate (CAS 1644239-86-0) is a chemical compound with the molecular formula C22H25NO2 and a molecular weight of 335.4 g/mol. IUPAC name: tert-butyl 2-(1-benzhydrylazetidin-3-ylidene)acetate. InChIKey: DYJHQOQRLJCDDV-UHFFFAOYSA-N.
| Molecular formula | C22H25NO2 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | tert-butyl 2-(1-benzhydrylazetidin-3-ylidene)acetate |
| InChIKey | DYJHQOQRLJCDDV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C=C1CN(C1)C(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)