Products 1644277-00-8
CAS 1644277-00-8 appears in our catalog under these names: 4–Methyl–7–(4–nitrophenoxy)–2H–chromen–2–one, 4-Methyl-7-(4-nitrophenoxy)-2H-chromen-2-one. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 25 mg, 5 mg, 10 mg, 1 mg.
4-methyl-7-(4-nitrophenoxy)chromen-2-one (CAS 1644277-00-8) is a chemical compound with the molecular formula C16H11NO5 and a molecular weight of 297.26 g/mol. IUPAC name: 4-methyl-7-(4-nitrophenoxy)chromen-2-one. InChIKey: QRBYWJMPNMMLMY-UHFFFAOYSA-N.
| Molecular formula | C16H11NO5 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | 4-methyl-7-(4-nitrophenoxy)chromen-2-one |
| InChIKey | QRBYWJMPNMMLMY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)