CAS 164522-90-1 appears in our catalog under these names: 4-(3-Chlorophenoxy)benzaldehyde, 95%, 4-(3-Chlorophenoxy)benzaldehyde 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
4-(3-chlorophenoxy)benzaldehyde (CAS 164522-90-1) is a chemical compound with the molecular formula C13H9ClO2 and a molecular weight of 232.66 g/mol. IUPAC name: 4-(3-chlorophenoxy)benzaldehyde. InChIKey: BGMYGFFWBQIXHN-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO2 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | 4-(3-chlorophenoxy)benzaldehyde |
| InChIKey | BGMYGFFWBQIXHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)OC2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)