CAS 4655-10-1 appears in our catalog under these names: 4'-Chlorobiphenyl-3-carboxylic acid, 98%, 4'-Chloro-biphenyl-3-carboxylic acid, 98%, 4'-Chloro-[1,1'-biphenyl]-3-carboxylic acid, 95%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
3-(4-chlorophenyl)benzoic acid (CAS 4655-10-1) is a chemical compound with the molecular formula C13H9ClO2 and a molecular weight of 232.66 g/mol. IUPAC name: 3-(4-chlorophenyl)benzoic acid. InChIKey: OWFMSKZVCPGDEJ-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO2 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | 3-(4-chlorophenyl)benzoic acid |
| InChIKey | OWFMSKZVCPGDEJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)