CAS 5748-41-4 appears in our catalog under these names: 4–(4–Chlorophenyl)benzoic acid, 4-(4-Chlorophenyl)benzoic acid, 97%, 4'-Chlorobiphenyl-4-carboxylic acid, 98%, 4'-Chloro-[1,1'-biphenyl]-4-carboxylic acid, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 25g.
4-(4-chlorophenyl)benzoic acid (CAS 5748-41-4) is a chemical compound with the molecular formula C13H9ClO2 and a molecular weight of 232.66 g/mol. IUPAC name: 4-(4-chlorophenyl)benzoic acid. InChIKey: FIMRRWLTRBEAOM-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO2 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | 4-(4-chlorophenyl)benzoic acid |
| InChIKey | FIMRRWLTRBEAOM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)