Products 5728-43-8
CAS 5728-43-8 appears in our catalog under these names: 4-(3-Chlorophenyl)benzoic acid, 98%, 3'-Chloro-biphenyl-4-carboxylic acid, 3'-Chloro-[1,1'-biphenyl]-4-carboxylic acid 98%, 4-(3-Chlorophenyl)benzoic acid, 98%, 98%, 3'-Chlorobiphenyl-4-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 50g, 100g.
4-(3-chlorophenyl)benzoic acid (CAS 5728-43-8) is a chemical compound with the molecular formula C13H9ClO2 and a molecular weight of 232.66 g/mol. IUPAC name: 4-(3-chlorophenyl)benzoic acid. InChIKey: SJIVTXJWSYIMDG-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO2 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | 4-(3-chlorophenyl)benzoic acid |
| InChIKey | SJIVTXJWSYIMDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3'-Chloro-biphenyl-4-carboxylic acid, 4-(3-chlorophenyl)benzoic Acid, 3'-Chloro-[1,1'-biphenyl]-4-carboxylic acid, 3'-Chlorobiphenyl-4-carboxylic acid, 4-Biphenyl-3'-chloro-carboxylic acid, 3'-chloro-4-biphenylcarboxylic acid, 3'-chloro[1,1'-biphenyl]-4-carboxylic acid, 4-Carboxy-3'-chlorobiphenyl, 3'-chloro-1,1'-biphenyl-4-carboxylic acid, 3'-Chloro-[1,1'-biphenyl]-4-carboxylicacid