CAS 164526-16-3 is the registry number for (7-Amino-2,3-dihydrobenzo(b)(1,4)dioxin-6-yl)(2-chlorophenyl)methanone, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-(2-chlorophenyl)methanone (CAS 164526-16-3) is a chemical compound with the molecular formula C15H12ClNO3 and a molecular weight of 289.71 g/mol. IUPAC name: (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-(2-chlorophenyl)methanone. InChIKey: SECGECYWPBXWCM-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO3 |
|---|---|
| Molecular weight | 289.71 g/mol |
| IUPAC name | (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-(2-chlorophenyl)methanone |
| InChIKey | SECGECYWPBXWCM-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)N)C(=O)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)