CAS 379726-31-5 appears in our catalog under these names: 2-Chloro-n-(2-methoxydibenzo[b,d]furan-3-yl)acetamide, 95%, 2-Chloro-N-(2-methoxydibenzo(b,d)furan-3-yl)acetamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-chloro-N-(2-methoxydibenzofuran-3-yl)acetamide (CAS 379726-31-5) is a chemical compound with the molecular formula C15H12ClNO3 and a molecular weight of 289.71 g/mol. IUPAC name: 2-chloro-N-(2-methoxydibenzofuran-3-yl)acetamide. InChIKey: SEBCXKSTMITXLV-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO3 |
|---|---|
| Molecular weight | 289.71 g/mol |
| IUPAC name | 2-chloro-N-(2-methoxydibenzofuran-3-yl)acetamide |
| InChIKey | SEBCXKSTMITXLV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C3=CC=CC=C3O2)NC(=O)CCl |
Computed by PubChem (NCBI)