CAS 930521-57-6 is the registry number for N-Benzyl-7-chlorobenzo[d][1,3]dioxole-5-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-benzyl-7-chloro-1,3-benzodioxole-5-carboxamide (CAS 930521-57-6) is a chemical compound with the molecular formula C15H12ClNO3 and a molecular weight of 289.71 g/mol. IUPAC name: N-benzyl-7-chloro-1,3-benzodioxole-5-carboxamide. InChIKey: NBEONYRPVMCBIU-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO3 |
|---|---|
| Molecular weight | 289.71 g/mol |
| IUPAC name | N-benzyl-7-chloro-1,3-benzodioxole-5-carboxamide |
| InChIKey | NBEONYRPVMCBIU-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)C(=O)NCC3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)