CAS 70359-62-5 appears in our catalog under these names: α-Hydroxycarprofen, alpha-Hydroxycarprofen. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
2-(6-chloro-9H-carbazol-2-yl)-2-hydroxypropanoic acid (CAS 70359-62-5) is a chemical compound with the molecular formula C15H12ClNO3 and a molecular weight of 289.71 g/mol. IUPAC name: 2-(6-chloro-9H-carbazol-2-yl)-2-hydroxypropanoic acid. InChIKey: SDSSKDHMEVUOPE-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO3 |
|---|---|
| Molecular weight | 289.71 g/mol |
| IUPAC name | 2-(6-chloro-9H-carbazol-2-yl)-2-hydroxypropanoic acid |
| InChIKey | SDSSKDHMEVUOPE-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)C3=C(N2)C=CC(=C3)Cl)(C(=O)O)O |
Computed by PubChem (NCBI)