Products 1645267-41-9
CAS 1645267-41-9 is the registry number for B-[4-(4-Thiazolyl)phenyl]boronic acid, >95%. Offered by: Chemat. Available pack sizes: 100mg.
[4-(1,3-thiazol-4-yl)phenyl]boronic acid (CAS 1645267-41-9) is a chemical compound with the molecular formula C9H8BNO2S and a molecular weight of 205.05 g/mol. IUPAC name: [4-(1,3-thiazol-4-yl)phenyl]boronic acid. InChIKey: QUWMHXXRLMQPPT-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2S |
|---|---|
| Molecular weight | 205.05 g/mol |
| IUPAC name | [4-(1,3-thiazol-4-yl)phenyl]boronic acid |
| InChIKey | QUWMHXXRLMQPPT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CSC=N2)(O)O |
Computed by PubChem (NCBI)