Products 1646795-60-9
CAS 1646795-60-9 appears in our catalog under these names: KC02, (Z)-KC02, (Z)-KC02, 99.0%. Offered by: GLPBio, TargetMol, MedChemExpress. Available pack sizes: 5mg, 1mg, 100ug, 500ug, 1 mg (34.80 mM * 100 μL in Ethyl acetate).
(6Z)-6-[2-oxo-4-(2-phenylethyl)oxetan-3-ylidene]hexanamide (CAS 1646795-60-9) is a chemical compound with the molecular formula C17H21NO3 and a molecular weight of 287.35 g/mol. IUPAC name: (6Z)-6-[2-oxo-4-(2-phenylethyl)oxetan-3-ylidene]hexanamide. InChIKey: XWRBNJBEHUJLPT-ZROIWOOFSA-N.
| Molecular formula | C17H21NO3 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | (6Z)-6-[2-oxo-4-(2-phenylethyl)oxetan-3-ylidene]hexanamide |
| InChIKey | XWRBNJBEHUJLPT-ZROIWOOFSA-N |
| SMILES | C1=CC=C(C=C1)CCC2/C(=C/CCCCC(=O)N)/C(=O)O2 |
Computed by PubChem (NCBI)