Products 164789-02-0
CAS 164789-02-0 is the registry number for KAT-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-amino-4-(2-amino-5-chlorophenyl)-4-oxobutanoic acid (CAS 164789-02-0) is a chemical compound with the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. IUPAC name: 2-amino-4-(2-amino-5-chlorophenyl)-4-oxobutanoic acid. InChIKey: VCCXKKFHLAJBJJ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O3 |
|---|---|
| Molecular weight | 242.66 g/mol |
| IUPAC name | 2-amino-4-(2-amino-5-chlorophenyl)-4-oxobutanoic acid |
| InChIKey | VCCXKKFHLAJBJJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)CC(C(=O)O)N)N |
Computed by PubChem (NCBI)