CAS 1649998-91-3 is the registry number for 3,4-Dihydroxy-1(3H)-isobenzofuranone. Offered by: TRC. Available pack sizes: 500mg.
3,4-dihydroxy-3H-2-benzofuran-1-one (CAS 1649998-91-3) is a chemical compound with the molecular formula C8H6O4 and a molecular weight of 166.13 g/mol. IUPAC name: 3,4-dihydroxy-3H-2-benzofuran-1-one. InChIKey: AULYUZAKRLWPDD-UHFFFAOYSA-N.
| Molecular formula | C8H6O4 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 3,4-dihydroxy-3H-2-benzofuran-1-one |
| InChIKey | AULYUZAKRLWPDD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(OC2=O)O)C(=C1)O |
Computed by PubChem (NCBI)