CAS 165119-08-4 is the registry number for TCMDC-137332. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[2-(4-chlorophenoxy)phenyl]-2,2-dimethylpropanamide (CAS 165119-08-4) is a chemical compound with the molecular formula C17H18ClNO2 and a molecular weight of 303.8 g/mol. IUPAC name: N-[2-(4-chlorophenoxy)phenyl]-2,2-dimethylpropanamide. InChIKey: CLAKLBXBJFDOMB-UHFFFAOYSA-N.
| Molecular formula | C17H18ClNO2 |
|---|---|
| Molecular weight | 303.8 g/mol |
| IUPAC name | N-[2-(4-chlorophenoxy)phenyl]-2,2-dimethylpropanamide |
| InChIKey | CLAKLBXBJFDOMB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC=CC=C1OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)