CAS 1652549-44-4 is the registry number for (R)-2-((3,5-Dichloropyridin-2-yl)oxy)butanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]butanoic acid (CAS 1652549-44-4) is a chemical compound with the molecular formula C9H9Cl2NO3 and a molecular weight of 250.08 g/mol. IUPAC name: (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]butanoic acid. InChIKey: VMYITZCGPMSKFN-SSDOTTSWSA-N.
| Molecular formula | C9H9Cl2NO3 |
|---|---|
| Molecular weight | 250.08 g/mol |
| IUPAC name | (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]butanoic acid |
| InChIKey | VMYITZCGPMSKFN-SSDOTTSWSA-N |
| SMILES | CC[C@H](C(=O)O)OC1=C(C=C(C=N1)Cl)Cl |
Computed by PubChem (NCBI)