CAS 70149-51-8 is the registry number for Ethyl 2-(3,5-dichloro-4-oxopyridin-1(4H)-yl)acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(3,5-dichloro-4-oxo-1-pyridinyl)acetate (CAS 70149-51-8) is a chemical compound with the molecular formula C9H9Cl2NO3 and a molecular weight of 250.08 g/mol. IUPAC name: ethyl 2-(3,5-dichloro-4-oxo-1-pyridinyl)acetate. InChIKey: WEFJPWOOBWCWLZ-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO3 |
|---|---|
| Molecular weight | 250.08 g/mol |
| IUPAC name | ethyl 2-(3,5-dichloro-4-oxo-1-pyridinyl)acetate |
| InChIKey | WEFJPWOOBWCWLZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C=C(C(=O)C(=C1)Cl)Cl |
Computed by PubChem (NCBI)