Products 1881332-22-4
CAS 1881332-22-4 is the registry number for 2,3-dichloro-1-nitro-4-propoxybenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,3-dichloro-1-nitro-4-propoxybenzene (CAS 1881332-22-4) is a chemical compound with the molecular formula C9H9Cl2NO3 and a molecular weight of 250.08 g/mol. IUPAC name: 2,3-dichloro-1-nitro-4-propoxybenzene. InChIKey: QYSQGGAPEQFMCB-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO3 |
|---|---|
| Molecular weight | 250.08 g/mol |
| IUPAC name | 2,3-dichloro-1-nitro-4-propoxybenzene |
| InChIKey | QYSQGGAPEQFMCB-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C(=C(C=C1)[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)