Products 181434-34-4
CAS 181434-34-4 is the registry number for Methyl 2-amino-3,5-dichloro-4-methoxybenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-amino-3,5-dichloro-4-methoxybenzoate (CAS 181434-34-4) is a chemical compound with the molecular formula C9H9Cl2NO3 and a molecular weight of 250.08 g/mol. IUPAC name: methyl 2-amino-3,5-dichloro-4-methoxybenzoate. InChIKey: HXYTUUUJFJVLKL-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO3 |
|---|---|
| Molecular weight | 250.08 g/mol |
| IUPAC name | methyl 2-amino-3,5-dichloro-4-methoxybenzoate |
| InChIKey | HXYTUUUJFJVLKL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1Cl)N)C(=O)OC)Cl |
Computed by PubChem (NCBI)