CAS 2918775-45-6 is the registry number for Methyl (R)-2-(3,5-dichloro-2-oxopyridin-1(2H)-yl)propanoate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl (2R)-2-(3,5-dichloro-2-oxo-1-pyridinyl)propanoate (CAS 2918775-45-6) is a chemical compound with the molecular formula C9H9Cl2NO3 and a molecular weight of 250.08 g/mol. IUPAC name: methyl (2R)-2-(3,5-dichloro-2-oxo-1-pyridinyl)propanoate. InChIKey: OFIARUDPKCQUMK-RXMQYKEDSA-N.
| Molecular formula | C9H9Cl2NO3 |
|---|---|
| Molecular weight | 250.08 g/mol |
| IUPAC name | methyl (2R)-2-(3,5-dichloro-2-oxo-1-pyridinyl)propanoate |
| InChIKey | OFIARUDPKCQUMK-RXMQYKEDSA-N |
| SMILES | C[C@H](C(=O)OC)N1C=C(C=C(C1=O)Cl)Cl |
Computed by PubChem (NCBI)