CAS 165748-13-0 is the registry number for Methyl (S)-1,2,3,4-tetrahydroquinoline-2-carboxylate 4-methylbenzenesulfonate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-methylbenzenesulfonic acid;methyl (2S)-1,2,3,4-tetrahydroquinoline-2-carboxylate (CAS 165748-13-0) is a chemical compound with the molecular formula C18H21NO5S and a molecular weight of 363.4 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;methyl (2S)-1,2,3,4-tetrahydroquinoline-2-carboxylate. InChIKey: CGZSXJLKLMQWRH-PPHPATTJSA-N.
| Molecular formula | C18H21NO5S |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;methyl (2S)-1,2,3,4-tetrahydroquinoline-2-carboxylate |
| InChIKey | CGZSXJLKLMQWRH-PPHPATTJSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.COC(=O)[C@@H]1CCC2=CC=CC=C2N1 |
Computed by PubChem (NCBI)