Products 2476465-11-7
CAS 2476465-11-7 appears in our catalog under these names: Febuxostat Impurity 39, 3-Descyano-3-ethoxycarbonyl Febuxostat, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 2,5mg, 25mg.
2-[3-ethoxycarbonyl-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 2476465-11-7) is a chemical compound with the molecular formula C18H21NO5S and a molecular weight of 363.4 g/mol. IUPAC name: 2-[3-ethoxycarbonyl-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: GHFPFSGEXSZUCQ-UHFFFAOYSA-N.
| Molecular formula | C18H21NO5S |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 2-[3-ethoxycarbonyl-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | GHFPFSGEXSZUCQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)C2=NC(=C(S2)C(=O)O)C)OCC(C)C |
Computed by PubChem (NCBI)